Code archives/User Libs/FreeImage Module for B3D/B+
This code has been declared by its author to be Public Domain code.
Download source code
| The decls have been updated to FreeImage.dll 3.10.0. The FreeImage.dll can be found inside the binary distribution: http://freeimage.sourceforge.net/ FreeImage is an open source project and is free to license (use the FreeImage licence version). The module can now be downloaded here (Freeimage.dll not included): http://blitzmirror.angelfire.com/ Copy/paste this code and save it as "freeimage.bb". ;FreeImage Module for B3D/B+ ;Author: markcw, edited 29 Nov 08 ;Site: freeimage.sourceforge.net/ ;Load and save image functions Function FiLoadImage(filename$) ;Loads an image from filename$ ;Returns an image or False if fails ;Uses FiLoad and FiRead Local dib, image dib = FiLoad(filename$) image = FiRead(dib) FreeImage_Unload(dib) Return image End Function Function FiSaveImage(image, filename$) ;Saves an image as filename$ ;Returns True if succeeds or False if fails ;Uses FiWrite and FiSave Local dib, bool dib = FiWrite(image) bool = FiSave(dib, filename$) FreeImage_Unload(dib) Return bool End Function Function FiLoad(filename$) ;Loads a FreeImage bitmap from filename$ ;Returns a FreeImage bitmap or False if fails Local fif, dib fif = FreeImage_GetFIFFromFilename(filename$) ;Format from extension If fif >= 0 ;Format is valid dib = FreeImage_Load(fif, filename$, 0) EndIf Return dib End Function Function FiRead(dib) ;Reads a FreeImage bitmap and writes an image ;Returns an image or False if fails Local dib24, pixel, width, height, image, buffer, ix, iy dib24 = FreeImage_ConvertTo24Bits(dib) ;Copy to 24 bit, no palette If dib24 = 0 Then Return 0 ;Unknown format pixel = CreateBank(4) ;Temp bank width = FreeImage_GetWidth(dib) height = FreeImage_GetHeight(dib) image = CreateImage(width, height) buffer = GraphicsBuffer() LockBuffer(ImageBuffer(image)) For iy = 0 To height - 1 For ix = 0 To width - 1 FreeImage_GetPixelColor(dib24, ix, height - 1 - iy, pixel) ;Invert WritePixelFast ix, iy, PeekInt(pixel, 0), ImageBuffer(image) Next Next UnlockBuffer(ImageBuffer(image)) SetBuffer buffer FreeImage_Unload(dib24) FreeBank pixel Return image End Function Function FiSave(dib, filename$) ;Saves a FreeImage bitmap as filename$ ;Returns True if succeeds or False if fails Local fif, bpp, dib8, dib24, bool If dib = 0 Then Return 0 ;No image fif = FreeImage_GetFIFFromFilename(filename$) ;Format from extension bpp = FreeImage_GetBPP(dib) ;bpp will be one of 1/4/8/16/24/32 dib8 = dib ;8 bit or other, variable passed to FreeImage_Save dib24 = dib ;24 bit If fif >= 0 ;Format is valid If fif = 11 ;Check pgm format, pgm=11/pgmraw=12 dib8 = FreeImage_ConvertToGreyscale(dib) ;8 bit greyscale ElseIf fif = 25 ;Gif format, gif=25 If bpp <> 24 ;Dib not 24 bits dib24 = FreeImage_ConvertTo24Bits(dib) EndIf dib8 = FreeImage_ColorQuantize(dib24, 0) ;8 bit paletted If dib24 <> dib ;24 bit conversion was required FreeImage_Unload(dib24) EndIf EndIf bool = FreeImage_Save(fif, dib8, filename$, 0) If dib8 <> dib ;8 bit conversion was required FreeImage_Unload(dib8) EndIf EndIf Return bool End Function Function FiWrite(image) ;Reads an image and writes a FreeImage bitmap ;Returns a FreeImage bitmap or False if fails Local pixel, width, height, dib, buffer, ix, iy If image = 0 Then Return 0 ;No image pixel = CreateBank(4) ;Temp bank width = ImageWidth(image) height = ImageHeight(image) dib = FreeImage_Allocate(width, height, 24, $ff0000, $00ff00, $0000ff) buffer = GraphicsBuffer() LockBuffer(ImageBuffer(image)) For iy = 0 To height - 1 For ix = 0 To width - 1 PokeInt pixel, 0, ReadPixelFast(ix, iy, ImageBuffer(image)) FreeImage_SetPixelColor(dib, ix, height - 1 - iy, pixel) ;Invert Next Next UnlockBuffer(ImageBuffer(image)) SetBuffer buffer FreeBank pixel Return dib End Function Function FiUnload(dib) ;Frees a FreeImage bitmap, a wrapper function ;Returns nothing FreeImage_Unload(dib) End Function ;Load and save anim image functions Function FiLoadAnimImage(filename$, index = 0, frames = 0) ;Loads an anim image from a FreeImage multipage bitmap ;index -> first frame, 0=first, frames -> number of frames, 0=all ;Returns an image or False if fails ;Uses FiOpenAnim Local dib, count, pixel, page, width, height Local image, graphic, buffer, dib24, ix, iy, dst dib = FiOpenAnim(filename$, 1) ;Load read-only If dib = 0 Then Return 0 ;No dib count = FreeImage_GetPageCount(dib) ;Number of frames If index < 0 Or index > count - 1 Then index = count - 1 If frames < 1 Or frames > count Then frames = count If frames + index > count Then frames = count - index pixel = CreateBank(4) page = FreeImage_LockPage(dib, 0) ;Lock first page width = FreeImage_GetWidth(page) ;Get the width/height height = FreeImage_GetHeight(page) FreeImage_UnlockPage(dib, page, 0) ;Unlock image = CreateImage(width, height, frames) graphic = CreateImage(width, height) buffer = GraphicsBuffer() For count = 0 To index + frames - 1 page = FreeImage_LockPage(dib, count) ;Lock next page dib24 = FreeImage_ConvertTo24Bits(page) ;Copy to 24 bits, no palette FreeImage_UnlockPage(dib, page, 0) ;Unlock LockBuffer(ImageBuffer(graphic)) For iy = 0 To height - 1 For ix = 0 To width - 1 FreeImage_GetPixelColor(dib24, ix, height - 1 - iy, pixel) ;Invert WritePixelFast ix, iy, PeekInt(pixel, 0), ImageBuffer(graphic) Next Next UnlockBuffer(ImageBuffer(graphic)) If count - index >= 0 ;Frame is valid dst = ImageBuffer(image, count - index) ;Copy graphic to frame CopyRect 0, 0, width, height, 0, 0, ImageBuffer(graphic), dst EndIf FreeImage_Unload(dib24) ;Free dib Next SetBuffer buffer FreeImage graphic FreeBank pixel FreeImage_CloseMultiBitmap(dib, 0) Return image End Function Function FiSaveAnimImage(image, filename$, frames, index = 0) ;Saves an anim image as filename$ ;frames -> number of frames, index -> first frame, 0=first ;Returns True if succeeds or False if fails ;Uses FiOpenAnim Local dib, fif, pixel, width, height, dib24 Local buffer, count, ix, iy, page If image = 0 Then Return 0 ;No image dib = FiOpenAnim(filename$, 2, 0) ;2=create new fif = FreeImage_GetFIFFromFilename(filename$) ;format from extension frames = frames + index If frames < 1 Then frames = 1 ;Limit If index < 0 Or index > frames - 1 Then index = frames - 1 pixel = CreateBank(4) ;Temp bank width = ImageWidth(image) height = ImageHeight(image) dib24 = FreeImage_Allocate(width, height, 24, $ff0000, $00ff00, $0000ff) buffer = GraphicsBuffer() For count = index To frames - 1 LockBuffer(ImageBuffer(image, count)) For iy = 0 To height - 1 For ix = 0 To width - 1 PokeInt pixel, 0, ReadPixelFast(ix, iy, ImageBuffer(image, count)) FreeImage_SetPixelColor(dib24, ix, height - 1 - iy, pixel) ;Invert Next Next UnlockBuffer(ImageBuffer(image, count)) If fif = 25 ;Gif format page = FreeImage_ColorQuantize(dib24, 0) ;8 bit palette Else ;Other format, ico=1/tif=18 page = FreeImage_ConvertTo24Bits(dib24) ;24 bits EndIf FreeImage_AppendPage(dib, page) ;Add next page FreeImage_Unload(page) Next SetBuffer buffer FreeBank pixel FreeImage_Unload(dib24) FreeImage_CloseMultiBitmap(dib, 0) Return 1 End Function Function FiAnimFrames(filename$, index = 0, frames = 0) ;Returns the number of frames in a FreeImage multipage bitmap ;index -> first frame, 0=first, frames -> number of frames, 0=all ;Uses FiOpenAnim Local dib, count dib = FiOpenAnim(filename$, 1) ;Load as read-only count = FreeImage_GetPageCount(dib) If index < 0 Or index > count - 1 Then index = count - 1 If frames < 1 Or frames > count Then frames = count If frames + index > count Then frames = count - index FreeImage_CloseMultiBitmap(dib, 0) Return frames End Function Function FiOpenAnim(filename$, opentype = 0, flags = 0) ;Opens a FreeImage multipage bitmap from filename$ ;opentype -> 0=open read/write, 1=open read-only, 2=create new ;Returns a FreeImage multipage bitmap or False if fails Local fif, dib, isnew, isread If opentype = 1 Then isread = 1 If opentype = 2 Then isnew = 1 fif = FreeImage_GetFIFFromFilename(filename$) ;Format from extension If fif >= 0 ;Format is valid dib = FreeImage_OpenMultiBitmap(fif, filename$, isnew, isread, 0, flags) EndIf Return dib End Function Function FiCloseAnim(dib, flags = 0) ;Closes a FreeImage multipage bitmap, a wrapper function ;Returns nothing FreeImage_CloseMultiBitmap(dib, flags) End Function ;Image manipulation functions Function FiRescale(dib, scale, filter = 0) ;Rescales a FreeImage bitmap ;scale -> scale as percentage, filter -> scale algorithm 0..5 ;Returns a rescaled FreeImage bitmap or False if fails Local width, height width = (scale * FreeImage_GetWidth(dib)) / 100 height = (scale * FreeImage_GetHeight(dib)) / 100 Return FreeImage_Rescale(dib, width, height, filter) End Function Function FiRotateClassic(dib, angle#) ;Rotates a FreeImage bitmap by a degree, 0..360 ;Returns a rotated FreeImage bitmap Local dlo, dhi angle# = -angle# ;Invert angle dlo = FiFloatToDouble(angle#, 0) dhi = FiFloatToDouble(angle#, 1) Return FreeImage_RotateClassic(dib, dlo, dhi) End Function Function FiRotateClassicEx(dib, angle#, bgcolor = 0) ;Rotates a FreeImage bitmap by a degree, 0..360 ;bgcolor -> RGB background color ;Returns a rotated FreeImage bitmap ;From FreeImage source by Hervé Drolon ;NB: sub-functions need 16/24/32 bits per pixel Local bpp, hsrc, hdst bpp = FreeImage_GetBPP(dib) hsrc = dib ;Init source If bpp < 16 ;Image is 1/4/8 bits per pixel hsrc = FreeImage_ConvertTo24Bits(dib) ;Copy to 24 bits EndIf hdst = FiRotateAny(hsrc, angle#, bgcolor) If hsrc <> dib ;Conversion required FreeImage_Unload(hsrc) ;Free from memory EndIf Return hdst End Function Function FiAdjustGamma(dib, gamma#) ;Adjust gamma correction on a 8/24/32-bit FreeImage bitmap, 0.1..10.0 ;A value of 1.0 leaves the image alone ;less than one darkens it, and greater than one lightens it ;Returns True if succeeds or False if fails Local dlo, dhi dlo = FiFloatToDouble(gamma#, 0) dhi = FiFloatToDouble(gamma#, 1) Return FreeImage_AdjustGamma(dib, dlo, dhi) End Function Function FiAdjustBrightness(dib, brightness#) ;Adjusts the brightness of a 8/24/32-bit FreeImage bitmap, -100..100 ;A value 0 means no change, less than 0 will make the image darker ;and greater than 0 will make the image brighter ;Note: FreeImage_AdjustBrightness is actually an intensity algorithm ;Adapted from FreeImage source by Hervé Drolon Local plut, i, value#, bool plut = CreateBank(256) ;Lookup table If brightness# > 100 Then brightness# = 100 ;-100..100 If brightness# < -100 Then brightness# = -100 For i = 0 To 255 ;Build the lut value# = i + (255 * brightness# / 100) ;Calc brightness If value# > 255 Then value# = 255 ;value 0..255 If value# < 0 Then value# = 0 PokeByte plut, i, Floor(value# + 0.5) Next bool = FreeImage_AdjustCurve(dib, plut, 0) ;Apply lut FreeBank plut ;Free from memory Return bool End Function Function FiAdjustIntensity(dib, intensity#) ;Adjusts the intensity of a 8/24/32-bit FreeImage bitmap, -100..100 ;A value 0 means no change, less than 0 will decrease the contrast ;and greater than 0 will increase the contrast ;Note: FreeImage_AdjustBrightness is actually an intensity algorithm ;From FreeImage source by Hervé Drolon Local plut, i, value#, bool plut = CreateBank(256) ;Lookup table If intensity# > 100 Then intensity# = 100 ;-100..100 If intensity# < -100 Then intensity# = -100 For i = 0 To 255 ;Build the lut value# = i * (100 + intensity#) / 100 ;Calc intensity If value# > 255 Then value# = 255 ;value 0..255 If value# < 0 Then value# = 0 PokeByte plut, i, Floor(value# + 0.5) Next bool = FreeImage_AdjustCurve(dib, plut, 0) ;Apply lut FreeBank plut ;Free from memory Return bool End Function Function FiAdjustContrast(dib, contrast#) ;Adjusts the contrast of a 8/24/32-bit FreeImage bitmap, -100..100 ;A value 0 means no change, less than 0 will decrease the contrast ;and greater than 0 will increase the contrast ;Returns True if succeeds or False if fails Local dlo, dhi dlo = FiFloatToDouble(contrast#, 0) dhi = FiFloatToDouble(contrast#, 1) Return FreeImage_AdjustContrast(dib, dlo, dhi) End Function ;Information functions Function FiGetWidth(dib) ;Returns the width of a FreeImage bitmap, a wrapper function Return FreeImage_GetWidth(dib) ;Get bitmap info End Function Function FiGetHeight(dib) ;Returns the height of a FreeImage bitmap, a wrapper function Return FreeImage_GetHeight(dib) End Function Function FiGetBPP(dib) ;Returns the bits per pixel of a FreeImage bitmap, a wrapper function Return FreeImage_GetBPP(dib) End Function ;Clipboard functions Function FiCopyToClipboard(dib) ;Copies a FreeImage bitmap to the clipboard ;Returns True is succeeds or False if fails ;Uses User32.dll And Kernel32.dll ;From: Copying a DIB to the clipboard, by John Simmons ;Site: www.codeproject.com Local phdr, ppal, pbits, sdib, sbits, bank, shdr, spal, hmem phdr = FreeImage_GetInfoHeader(dib) ;Pointer to info header ppal = FreeImage_GetPalette(dib) ;Pointer to palette pbits = FreeImage_GetBits(dib) ;Pointer to bits ;Calc bits, DWORD-aligned scanline (Pitch) * Height sbits = FreeImage_GetPitch(dib) * FreeImage_GetHeight(dib) sdib = FreeImage_GetDIBSize(dib) ;total size bank = CreateBank(sdib) ;Bank to store dib FiApiMemoryToBank(bank, phdr, 40) ;Move info header to bank shdr = PeekInt(bank, 0) ;biSize ;Calc palette, FreeImage bitmaps use the BITMAPINFO struct spal = PeekInt(bank, 32) ;biClrUsed If Not spal If PeekShort(bank, 14) <> 24 ;No color table for 24-bit spal = 1 Shl PeekShort(bank, 14) ;biBitCount, colors=2/16/256 EndIf EndIf spal = spal * 4 ;sizeof(RGBQUAD) ;Move bits, palette and header separately for proper alignment FiApiMemoryToBank(bank, pbits, sbits) ;Move bits to bank CopyBank bank, 0, bank, shdr + spal, sbits ;Move bits up FiApiMemoryToBank(bank, ppal, spal) ;Move palette to bank CopyBank bank, 0, bank, shdr, spal ;Move palette up FiApiMemoryToBank(bank, phdr, shdr) ;Move info header to bank ;Alloc memory block to store our dib hmem = FiApiGlobalAlloc(66, sdib) ;GHND=66, MOVEABLE=2|ZEROINIT=64 If Not hmem ;Major bummer if we couldn't get memory block FreeBank bank Return False ;Fail EndIf phdr = FiApiGlobalLock(hmem) ;Lock memory and get pointer to it FiApiBankToMemory(phdr, bank, sdib) ;Move dib to memory FiApiGlobalUnlock(hmem) ;Unlock the dib ;Send the dib to the clipboard If FiApiOpenClipboard(0) ;hwnd FiApiEmptyClipboard() ;Free last data FiApiSetClipboardData(8, hmem) ;CF_DIB=8, hdata[bitmap] FiApiCloseClipboard() EndIf FreeBank bank Return True ;Success End Function Function FiPasteFromClipboard() ;Pastes the clipboard to a new FreeImage bitmap ;Returns a FreeImage bitmap or dummy bitmap if fails ;Uses User32.dll And Kernel32.dll ;From: Copying a DIB to the clipboard, by John Simmons ;Site: www.codeproject.com Local hmem, dib, phdr, bank, shdr, spal, bw, bh Local bpp, sbits, sdib, ppal, pbits ;Receive the bitmap from the clipboard as a dib If FiApiOpenClipboard(0) ;hwnd hmem = FiApiGetClipboardData(8) ;CF_DIB=8 FiApiCloseClipboard() EndIf If Not hmem ;If we didn't get a dib, return a dummy bitmap dib = FreeImage_Allocate(1, 1, 24, $ff0000, $00ff00, $0000ff) Return dib ;Fail EndIf phdr = FiApiGlobalLock(hmem) ;Lock memory and get pointer to it bank = CreateBank(40) ;Init bank, we will resize it later FiApiMemoryToBank(bank, phdr, 40) ;Move info header to bank shdr = PeekInt(bank, 0) ;biSize ;Calc palette, Clipboard dibs use the BITMAPINFO struct spal = PeekInt(bank, 32) ;biClrUsed If Not spal If PeekShort(bank, 14) <> 24 ;No color table for 24-bit spal=1 Shl PeekShort(bank, 14) ;biBitCount, colors=2/16/256 EndIf EndIf spal = spal * 4 ;sizeof(RGBQUAD) bw = PeekInt(bank, 4) ;biWidth bh = PeekInt(bank, 8) ;biHeight bpp = PeekShort(bank, 14) ;biBitCount ;Calc bits, DWORD-aligned scanline (Width * BitCount) * Height sbits = ((bw * bpp + 31) / 32 * 4) * bh sdib = shdr + spal + sbits ;Total size ResizeBank bank, sdib ;Resize bank to store dib FiApiMemoryToBank(bank, phdr, sdib) ;Move dib to bank FiApiGlobalUnlock(hmem) ;Unlock the dib ;Alloc FreeImage bitmap, this has its own info header dib = FreeImage_Allocate(bw, bh, bpp, $ff0000, $00ff00, $0000ff) ppal = FreeImage_GetPalette(dib) ;Pointer to palette pbits = FreeImage_GetBits(dib) ;Pointer to bits ;Move palette and bits (not header) separately for proper alignment CopyBank bank, shdr, bank, 0, spal ;Move palette down FiApiBankToMemory(ppal, bank, spal) ;Move palette to memory CopyBank bank, shdr + spal, bank, 0, sbits ;Move bits down FiApiBankToMemory(pbits, bank, sbits) ;Move bits to memory FreeBank bank Return dib ;Success End Function ;Bank functions Function FiBankFromFile(filename$, size = 0, pos = 0) ;Creates and reads a bank from filename$ ;size -> file size, pos -> file position ;Returns a bank Local bank, file If size = 0 Then size = FileSize(filename$) bank = CreateBank(size) file = ReadFile(filename$) If file SeekFile(file, pos) ReadBytes(bank, file, 0, size) CloseFile(file) EndIf Return bank End Function Function FiBankToFile(bank, filename$, size = 0, pos = 0) ;Appends a bank to filename$ ;size -> file size, pos -> file position ;Returns True if succeeds or False if fails Local file If bank = 0 Then Return 0 ;No bank If size = 0 Then size = FileSize(filename$) file = OpenFile(filename$) ;Existing file If file = 0 Then file = WriteFile(filename$) ;New file If file SeekFile(file, pos) WriteBytes(bank, file, 0, size) CloseFile(file) file = 1 EndIf Return file End Function Function FiLoadFromBank(bank) ;Loads a FreeImage bitmap from a bank ;Returns a FreeImage bitmap or False if fails Local stream, fif, dib If bank = 0 Then Return 0 ;No bank stream = FreeImage_OpenMemory(bank, BankSize(bank)) ;Attach to memory fif = FreeImage_GetFileTypeFromMemory(stream, 0) ;Format from filetype If fif >= 0 ;Format is valid dib = FreeImage_LoadFromMemory(fif, stream, 0) ;Load from memory EndIf FreeImage_CloseMemory(stream) ;Close memory Return dib End Function ;Zlib functions Function FiZlibLoadImage(filename$, datafile$) ;Loads an image from a zlib compressed file stored in datafile$ ;Returns an image ;Uses FiZlibUnpack, FiLoadFromBank and FiRead Local bank, dib, image bank = FiZlibUnpack(filename$, datafile$) dib = FiLoadFromBank(bank) image = FiRead(dib) FreeBank bank FreeImage_Unload(dib) Return image End Function Function FiZlibPack(filename$, datafile$) ;Compresses a file with zlib and appends it to datafile$ ;Returns True if succeeds or False if fails ;Uses FiBankFromFile and FiBankToFile Local file, hdrsize, pos, dstsize, srcsize Local dataname$, count, srcbank, dstbank file = ReadFile(datafile$) If file ;Check if file exists hdrsize = ReadInt(file) ;"zlib" file type header While Not Eof(file) pos = FilePos(file) dstsize = ReadInt(file) srcsize = ReadInt(file) dataname$ = "" For count = 1 To Len(filename$) dataname$ = dataname$ + Chr(ReadByte(file)) Next If filename$ = dataname$ Then count = -1 : Exit ;Found file SeekFile(file, pos + dstsize) ;Next file block Wend CloseFile(file) If count < 0 Then Return 1 ;File exists, don't save EndIf srcsize = FileSize(filename$) ;Load uncompressed file hdrsize = Len(filename$) + 9 dstsize = srcsize + Int(srcsize * 0.1) + 12 srcbank = FiBankFromFile(filename$, dstsize + hdrsize) dstbank = CreateBank(dstsize + hdrsize) ;Compress file dstsize = FreeImage_ZLibCompress(dstbank, dstsize, srcbank, srcsize) CopyBank dstbank, 0, srcbank, hdrsize, dstsize ;Room for header PokeInt srcbank, 0, dstsize + hdrsize ;Compressed + header size PokeInt srcbank, 4, srcsize ;Uncompressed size For count = 1 To Len(filename$) ;Filename PokeByte srcbank, count + 7, Asc(Mid(filename$, count, 1)) Next PokeByte srcbank, hdrsize - 1, 0 ;Null terminator If FileType(datafile$) = 0 ;File doesn't exist file = WriteFile(datafile$) WriteInt file, $62696c7a ;"zlib" file type header CloseFile(file) EndIf srcsize = FileSize(datafile$) ;Save compressed file FiBankToFile(srcbank, datafile$, dstsize + hdrsize, srcsize) FreeBank dstbank FreeBank srcbank Return file End Function Function FiZlibUnpack(filename$, datafile$) ;Uncompresses a zlib compressed file stored in datafile$ ;Returns a bank or False if fails ;Uses FiBankFromFile Local file, hdrsize, pos, dstsize, srcsize Local dataname$, count, srcbank, dstbank file = ReadFile(datafile$) If file ;Check if file exists hdrsize = ReadInt(file) ;"zlib" file type header While Not Eof(file) pos = FilePos(file) dstsize = ReadInt(file) srcsize = ReadInt(file) dataname$ = "" For count = 1 To Len(filename$) dataname$ = dataname$ + Chr(ReadByte(file)) Next If filename$ = dataname$ Then count = -1 : Exit ;Found file SeekFile(file, pos + dstsize) ;Next file block Wend CloseFile(file) If count >= 0 Then Return 0 ;File doesn't exist, don't load EndIf hdrsize = Len(filename$) + 9 ;Load compressed file dstsize = dstsize - hdrsize srcbank = FiBankFromFile(datafile$, srcsize, pos + hdrsize) dstbank = CreateBank(srcsize) ;Uncompress file dstsize = FreeImage_ZLibUncompress(dstbank, srcsize, srcbank, dstsize) FreeBank srcbank Return dstbank End Function Function FiGZipLoadImage(filename$, datafile$) ;Loads an image from a gzip compressed file stored in datafile$ ;Returns an image ;Uses FiGUnzip, FiLoadFromBank and FiRead Local bank, dib, image bank = FiGUnzip(filename$, datafile$) dib = FiLoadFromBank(bank) image = FiRead(dib) FreeBank bank FreeImage_Unload(dib) Return image End Function Function FiGZip(filename$, datafile$) ;Compresses a file with gzip and appends it to datafile$ ;Returns True if succeeds or False if fails ;Uses FiBankFromFile and FiBankToFile Local file, hdrsize, pos, dstsize, srcsize Local dataname$, count, srcbank, dstbank file = ReadFile(datafile$) If file ;Check if file exists hdrsize = ReadInt(file) ;"gzip" file type header While Not Eof(file) pos = FilePos(file) dstsize = ReadInt(file) srcsize = ReadInt(file) dataname$ = "" For count = 1 To Len(filename$) dataname$ = dataname$ + Chr(ReadByte(file)) Next If filename$ = dataname$ Then count = -1 : Exit ;Found file SeekFile(file, pos + dstsize) ;Next file block Wend CloseFile(file) If count < 0 Then Return 1 ;File exists, don't save EndIf srcsize = FileSize(filename$) ;Load uncompressed file hdrsize = Len(filename$) + 9 dstsize = srcsize + Int(srcsize * 0.1) + 24 srcbank = FiBankFromFile(filename$, dstsize + hdrsize) dstbank = CreateBank(dstsize + hdrsize) ;Compress file dstsize = FreeImage_ZLibGZip(dstbank, dstsize, srcbank, srcsize) CopyBank dstbank, 0, srcbank, hdrsize, dstsize ;Room for header PokeInt srcbank, 0, dstsize + hdrsize ;Compressed + header size PokeInt srcbank, 4, srcsize ;Uncompressed size For count = 1 To Len(filename$) ;Filename PokeByte srcbank, count + 7, Asc(Mid(filename$, count, 1)) Next PokeByte srcbank, hdrsize - 1, 0 ;Null terminator If FileType(datafile$) = 0 ;File doesn't exist file = WriteFile(datafile$) WriteInt file, $70697a67 ;"gzip" file type header CloseFile(file) EndIf srcsize = FileSize(datafile$) ;Save compressed file FiBankToFile(srcbank, datafile$, dstsize + hdrsize, srcsize) FreeBank dstbank FreeBank srcbank Return file End Function Function FiGUnzip(filename$, datafile$) ;Uncompresses a gzip compressed file stored in datafile$ ;Returns a bank or False if fails ;Uses FiBankFromFile Local file, hdrsize, pos, dstsize, srcsize Local dataname$, count, srcbank, dstbank file = ReadFile(datafile$) If file ;Check if file exists hdrsize = ReadInt(file) ;"gzip" file type header While Not Eof(file) pos = FilePos(file) dstsize = ReadInt(file) srcsize = ReadInt(file) dataname$ = "" For count = 1 To Len(filename$) dataname$ = dataname$ + Chr(ReadByte(file)) Next If filename$ = dataname$ Then count = -1 : Exit ;Found file SeekFile(file, pos + dstsize) ;Next file block Wend CloseFile(file) If count >= 0 Then Return 0 ;File doesn't exist, don't load EndIf hdrsize = Len(filename$) + 9 ;Load compressed file dstsize = dstsize - hdrsize srcbank = FiBankFromFile(datafile$, srcsize, pos + hdrsize) dstbank = CreateBank(srcsize) ;Uncompress file dstsize = FreeImage_ZLibGUnzip(dstbank, srcsize, srcbank, dstsize) FreeBank srcbank Return dstbank End Function ;Memory stream functions Function FiSaveToMemory(filename$) ;Loads a FreeImage bitmap and saves it to a memory stream ;Returns a FreeImage memory stream or False if fails Local fif, dib, stream fif = FreeImage_GetFileType(filename$, 0) ;Format from filetype If fif >= 0 ;Format is valid dib = FreeImage_Load(fif, filename$, 0) stream = FreeImage_OpenMemory(dib, 0) ;Attach to memory FreeImage_SaveToMemory(fif, dib, stream, 0) ;Save to memory FreeImage_Unload(dib) EndIf Return stream End Function Function FiLoadFromMemory(stream) ;Loads a FreeImage bitmap from a memory stream ;Returns a FreeImage bitmap or False if fails Local fif, dib FreeImage_SeekMemory(stream, 0, 0) ;Seek to memory start fif = FreeImage_GetFileTypeFromMemory(stream, 0) ;Format from memory If fif >= 0 ;Format is valid dib = FreeImage_LoadFromMemory(fif, stream, 0) EndIf Return dib End Function Function FiMemoryToFile(stream, filename$) ;Saves a memory stream as filename$ ;Assumes the file extension is known ;Returns True if succeeds or False if fails ;Uses Kernel32.dll Local buf, size, bank, file buf = CreateBank(4) ;Memory buffer size = CreateBank(4) ;Size of buffer FreeImage_AcquireMemory(stream, buf, size) ;Get buffer from stream bank = CreateBank(PeekInt(size, 0)) ;Bank for bitmap FiApiMemoryToBank(bank, PeekInt(buf, 0), PeekInt(size, 0)) ;Move to bank file = WriteFile(filename$) If file ;Check if file opened WriteBytes bank, file, 0, PeekInt(size, 0) CloseFile(file) EndIf FreeBank buf ;Free banks FreeBank size FreeBank bank If file Then file = 1 Return file End Function Function FiMemorySize(stream) ;Returns the size of a FreeImage bitmap in a memory stream Local size FreeImage_SeekMemory(stream, 0, 2) ;Seek to memory end size = FreeImage_TellMemory(stream) ;Memory position is file size Return size End Function Function FiCloseMemory(stream) ;Frees a FreeImage bitmap in a memory stream, a wrapper function ;Returns nothing FreeImage_CloseMemory(stream) End Function ;FiRotateClassicEx functions Function FiRotateAny(hsrc, angle#, bgcolor) ;Rotates an image by a degree. Angle is unlimited ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon Local hmid, hdst hmid = hsrc ;Init middle While angle# < 0 : angle# = angle# + 360 : Wend ;Wrap angle to 0..360 While angle# >= 360 : angle# = angle# - 360 : Wend If angle# > 45 And angle# <= 135 ;Angle in range 45..135 hmid = FiRotate90(hsrc) angle# = angle# - 90 ElseIf angle# > 135 And angle# <= 225 ;Angle in range 135..225 hmid = FiRotate180(hsrc) angle# = angle# - 180 ElseIf angle# > 225 And angle# <= 315 ;Angle in range 225..315 hmid = FiRotate270(hsrc) angle# = angle# - 270 EndIf If angle# = 0 ;Angle is 0 If hmid = hsrc ;Nothing to do Return FreeImage_Clone(hsrc) ;Clone handle Else ;No more rotation needed Return hmid ;Rotated handle, multiple of 90 EndIf Else ;Last rotation, angle in range -45..45 hdst = FiRotate45(hmid, angle#, bgcolor) If hmid <> hsrc ;Middle conversion required FreeImage_Unload(hmid) ;Free from memory EndIf Return hdst ;Rotated handle, sheared EndIf End Function Function FiRotate45(hsrc, angle#, bgcolor) ;Rotates an image by a degree in range -45..45 (counter clockwise) ;Using the 3-shear technique ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon Local bpp, sinv#, tanv#, srcw, srch, i, shear#, offset, weight Local w1, h1, hdst1, w2, h2, hdst2, w3, h3, hdst3 bpp = FreeImage_GetBPP(hsrc) ;Init values sinv# = Sin(angle#) tanv# = Tan(angle# / 2) srcw = FreeImage_GetWidth(hsrc) srch = FreeImage_GetHeight(hsrc) h1 = srch ;Calc 1st shear destination image dimensions w1 = srcw + Int(Float(srch) * Abs(tanv#) + 0.5) hdst1 = FreeImage_Allocate(w1, h1, bpp, 0, 0, 0) For i = 0 To h1 - 1 ;Perform 1st shear (horizontal) If tanv# >= 0 ;Positive angle shear# = (Float(i) + 0.5) * tanv# Else ;Negative angle shear# = (Float(Int(i) - h1) + 0.5) * tanv# EndIf offset = Int(Floor(shear#)) weight = 255 * (shear# - Float(offset)) ;Was weight+1 While weight < 0 : weight = weight + 256 : Wend ;Wrap byte to 0..255 While weight > 255 : weight = weight - 256 : Wend FiHorizontalSkew(hsrc, hdst1, i, offset, weight, bgcolor) Next w2 = w1 ;Calc 2nd shear destination image dimensions h2 = Float(srcw) * Abs(sinv#) + Float(srch) * Cos(angle#) + 0.5 hdst2 = FreeImage_Allocate(w2, h2, bpp, 0, 0, 0) If sinv# >= 0 ;Positive angle shear# = Float(srcw - 1) * sinv# Else ;Negative angle shear# = -sinv# * Float(srcw - w2) EndIf For i = 0 To w2 - 1 ;Perform 2nd shear (vertical) shear# = shear# - sinv# offset = Int(Floor(shear#)) weight = 255 * (shear# - Float(offset)) ;Was weight+1 While weight < 0 : weight = weight + 256 : Wend ;Wrap byte to 0..255 While weight > 255 : weight = weight - 256 : Wend offset = offset + 1 ;Was offset FiVerticalSkew(hdst1, hdst2, i, offset, weight, bgcolor) Next FreeImage_Unload(hdst1) ;Free 1st shear h3 = h2 ;Calc 3rd shear destination image dimensions w3 = Float(srch) * Abs(sinv#) + Float(srcw) * Cos(angle#) + 0.5 hdst3 = FreeImage_Allocate(w3, h3, bpp, 0, 0, 0) If sinv# >= 0 ;Positive angle shear# = Float(srcw - 1) * sinv#* - tanv# Else ;Negative angle shear# = tanv#*(Float(srcw - 1) * -sinv# + Float(1 - h3)) EndIf For i = 0 To h3 - 1 ;Perform 3rd shear (horizontal) shear# = shear# + tanv# offset = Int(Floor(shear#)) weight = 255 * (shear# - Float(offset)) ;Was weight+1 While weight < 0 : weight = weight + 256 : Wend ;Wrap byte to 0..255 While weight > 255 : weight = weight - 256 : Wend FiHorizontalSkew(hdst2, hdst3, i, offset, weight, bgcolor) Next FreeImage_Unload(hdst2) ;Free 2nd shear Return hdst3 ;3rd shear handle End Function Function FiHorizontalSkew(hsrc, hdst, row, offset, weight, bgcolor) ;Skews a row horizontally (with filtered weights) ;Limited to 45 degree skewing only. Filters two adjacent pixels ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon Local pxlsrc, pxlleft, pxloldleft, srcw, dstw, bytespp, i, j, ix, byte pxlsrc = CreateBank(12) ;4 byte arrays, for 32bit max pxlleft = 4 ;2nd array offset pxloldleft = 8 ;3rd array offset srcw = FreeImage_GetWidth(hsrc) + 2 ;Was srcw dstw = FreeImage_GetWidth(hdst) bytespp = FreeImage_GetLine(hsrc) / FreeImage_GetWidth(hsrc) For i = 0 To srcw - 1 ;Loop through row pixels PokeInt pxlsrc, 0, bgcolor ;Get background color If i > 0 And i < srcw - 1 ;Source in bounds FreeImage_GetPixelColor(hsrc, i - 1, row, pxlsrc) ;Was i EndIf For j = 0 To bytespp - 1 ;Calc weights PokeByte pxlsrc, j + pxlleft, PeekByte(pxlsrc, j) * weight / 256 Next ix = i + offset - 1 ;Was offset If ix >= 0 And ix < dstw ;Check boundaries For j = 0 To bytespp - 1 ;Update left over on source byte=PeekByte(pxlsrc, j + pxlleft) - PeekByte(pxlsrc, j + pxloldleft) PokeByte pxlsrc, j, PeekByte(pxlsrc, j) - byte Next FreeImage_SetPixelColor(hdst, ix, row, pxlsrc) EndIf For j = 0 To bytespp - 1 ;Save leftover for next pixel in scan PokeByte pxlsrc, j + pxloldleft, PeekByte(pxlsrc, j + pxlleft) Next Next PokeInt pxlsrc, 0, bgcolor ;Get background color ix = srcw + offset - 1 ;Go to rightmost point of skew, nb: offset While ix < dstw ;Fill gap right of skew with background FreeImage_SetPixelColor(hdst, ix, row, pxlsrc) ix = ix + 1 ;Was ix Wend If offset > 0 For j = 0 To offset - 1 ;Fill gap left of skew with background FreeImage_SetPixelColor(hdst, j, row, pxlsrc) Next EndIf FreeBank pxlsrc ;Free from memory End Function Function FiVerticalSkew(hsrc, hdst, col, offset, weight, bgcolor) ;Skews a column vertically (with filtered weights) ;Limited to 45 degree skewing only. Filters two adjacent pixels ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon Local pxlsrc, pxlleft, pxloldleft, srch, dsth, bytespp, i, j, iy, byte pxlsrc = CreateBank(12) ;4 byte arrays, for 32bit max pxlleft = 4 ;2nd array offset pxloldleft = 8 ;3rd array offset srch = FreeImage_GetHeight(hsrc) + 2 ;Was srch dsth = FreeImage_GetHeight(hdst) bytespp = FreeImage_GetLine(hsrc) / FreeImage_GetWidth(hsrc) For i = 0 To srch - 1 ;Loop through column pixels PokeInt pxlsrc, 0, bgcolor ;Get background color If i > 0 And i < srch - 1 ;Source in bounds FreeImage_GetPixelColor(hsrc, col, i - 1, pxlsrc) ;Was i EndIf For j = 0 To bytespp - 1 ;Calc weights PokeByte pxlsrc, j + pxlleft, PeekByte(pxlsrc, j) * weight / 256 Next iy = i + offset - 1 ;Was offset If iy >= 0 And iy < dsth ;Check boundaries For j = 0 To bytespp - 1 ;Update left over on source byte = PeekByte(pxlsrc, j + pxlleft) - PeekByte(pxlsrc, j + pxloldleft) PokeByte pxlsrc, j, PeekByte(pxlsrc, j) - byte Next FreeImage_SetPixelColor(hdst, col, iy, pxlsrc) EndIf For j = 0 To bytespp - 1 ;Save leftover for next pixel in scan PokeByte pxlsrc, j + pxloldleft, PeekByte(pxlsrc, j + pxlleft) Next Next PokeInt pxlsrc, 0, bgcolor ;Get background color iy = srch + offset - 1 ;Go to bottom point of skew, nb: offset While iy < dsth ;Fill gap below skew with background FreeImage_SetPixelColor(hdst, col, iy, pxlsrc) iy = iy + 1 ;Was iy Wend If offset > 0 For i = 0 To offset - 1 ;Fill gap above skew with background FreeImage_SetPixelColor(hdst, col, i, pxlsrc) Next EndIf FreeBank pxlsrc ;Free from memory End Function Function FiRotate90(hsrc) ;Rotates an image by 90 degrees (counter clockwise) ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon ;Code adapted from CxImage: www.xdp.it/cximage.htm Local pcolor, bpp, width, height, hdst, xs, ys, minw, minh, x, y, y2 pcolor = CreateBank(4) ;Bank structure, for 32 bit max bpp = FreeImage_GetBPP(hsrc) width = FreeImage_GetHeight(hsrc) height = FreeImage_GetWidth(hsrc) hdst = FreeImage_Allocate(width, height, bpp, 0, 0, 0) For ys = 0 To height - 1 Step 64 ;Loop for x-segment and y-segment For xs = 0 To width - 1 Step 64 ;64=rblock, size of image blocks minh = height : If ys + 64 < height Then minh = ys + 64 For y = ys To minh - 1 ;Do rotation y2 = height - y - 1 minw = width : If xs + 64 < width Then minw = xs + 64 For x = xs To minw - 1 FreeImage_GetPixelColor(hsrc, y2, x, pcolor) FreeImage_SetPixelColor(hdst, x, y, pcolor) Next Next Next Next FreeBank pcolor ;Free from memory Return hdst ;Rotated handle End Function Function FiRotate180(hsrc) ;Rotates an image by 180 degrees (counter clockwise) ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon Local pcolor, bpp, width, height, hdst, x, y pcolor = CreateBank(4) ;Bank structure, for 32 bit max bpp = FreeImage_GetBPP(hsrc) width = FreeImage_GetWidth(hsrc) height = FreeImage_GetHeight(hsrc) hdst = FreeImage_Allocate(width, height, bpp, 0, 0, 0) For y = 0 To height - 1 For x = 0 To width - 1 FreeImage_GetPixelColor(hsrc, x, y, pcolor) FreeImage_SetPixelColor(hdst, width - x - 1, height - y - 1, pcolor) Next Next FreeBank pcolor ;Free from memory Return hdst ;Rotated handle End Function Function FiRotate270(hsrc) ;Rotates an image by 270 degrees (counter clockwise) ;Used by FiRotateClassicEx ;From FreeImage source by Hervé Drolon ;Code adapted from CxImage: www.xdp.it/cximage.htm Local pcolor, bpp, width, height, hdst, xs, ys, minw, minh, x, y, x2 pcolor = CreateBank(4) ;Bank structure, for 32 bit max bpp = FreeImage_GetBPP(hsrc) width = FreeImage_GetHeight(hsrc) height = FreeImage_GetWidth(hsrc) hdst = FreeImage_Allocate(width, height, bpp, 0, 0, 0) For ys = 0 To height - 1 Step 64 ;Loop for x-segment and y-segment For xs = 0 To width - 1 Step 64 ;rblock=64, size of image blocks minw = width : If xs + 64 < width Then minw = xs + 64 For x = xs To minw - 1 ;Do rotation x2 = width - x - 1 minh = height : If ys + 64 < height Then minh = ys + 64 For y = ys To minh - 1 FreeImage_GetPixelColor(hsrc, y, x2, pcolor) FreeImage_SetPixelColor(hdst, x, y, pcolor) Next Next Next Next FreeBank pcolor ;Free from memory Return hdst ;Rotated handle End Function ;FloatToDouble functions Function FiFloatToDouble(value#, dpart = 0) ;Converts a float into a double as 2 integers ;dpart -> Double flag indicating which part to return, 0=dlo, 1=dhi ;Returns a low or high double integer - decimal equivalent of the float ;Site: techsupt.winbatch.com/TS/T000001034F21.html Local integer, sign, exponent, fraction, dexp, dlo, dhi integer = FiFloatToInt(value#) sign = integer And $80000000 ;Sign bit exponent = integer And $7F800000 ;8-bit exponent fraction = integer And $007FFFFF ;23-bit mantissa dexp = ((exponent Shr 23) - 127 + 1023) Shl 20 ;Double exponent dlo = (fraction And 7) Shl 29 dhi = sign Or dexp Or (fraction Shr 3) If dpart = 0 Then Return dlo Return dhi End Function Function FiDoubleToFloat#(dlo, dhi) ;Converts a double as 2 integers into a float ;dlo -> Low double integer, dhi -> High double integer ;Returns a float - decimal equivalent of the double as 2 integers ;Site: techsupt.winbatch.com/TS/T000001034F21.html Local dsgn, sign, dexp, exponent, fraction dsgn = Abs(dhi Shr 31) ;Double sign sign = dsgn Shl 31 ;Sign bit dexp = Abs((dhi Shr 20) - (dsgn Shl 11)) ;Double exponent exponent = (dexp + 127 - 1023) Shl 23 ;8-bit exponent fraction = ((dhi And $000FFFFF) Shl 3) + (dlo Shr 29) ;23-bit mantissa Return FiIntToFloat(sign Or exponent Or fraction) End Function Function FiFloatToInt(value#) ;Converts a float into a float as an integer ;Returns an integer that is the binary equivalent of the float ;Site: wiki.tcl.tk/756 Local sign, exponent, fraction# Local f1f#, f2f#, f3f#, se1, e2f1, f1, f2, f3 If value# > 0 Then sign = 0 Else sign = 1 value# = Abs(value#) exponent = Int(Floor(Log(value#) / 0.69314718055994529)) + 127 fraction# = (value# / (2 ^ (exponent - 127))) - 1 If exponent < 0 Then exponent = 0 : fraction# = 0.0 ;Round off to zero If exponent > 255 Then exponent = 255 ;Outside legal range for a float fraction# = fraction# * 128.0 f1f# = Floor(fraction#) fraction# = (fraction# - f1f#) * 256.0 f2f# = Floor(fraction#) fraction# = (fraction# - f2f#) * 256.0 f3f# = Floor(fraction#) f1 = Int(f1f#) : f2 = Int(f2f#) : f3 = Int(f3f#) se1 = (sign Shl 7) Or (exponent Shr 1) ;Sign and Exponent1 e2f1 = ((exponent And 1) Shl 7) Or f1 ;Exponent2 and Fraction1 Return (se1 Shl 24) Or (e2f1 Shl 16) Or (f2 Shl 8) Or f3 End Function Function FiIntToFloat#(value) ;Converts a float as an integer into a float ;Returns a float that is the binary equivalent of the integer ;Site: www.cs.princeton.edu/introcs/91float/ Local sign, exponent, fraction sign = (value And $80000000) Shr 31 exponent = (value And $7F800000) Shr 23 fraction = value And $007FFFFF Return (-1 ^ sign) * (2 ^ (exponent - 127)) * (1 + (fraction / (2 ^ 23))) End Function ;End of FreeImage Module Save these decls as "freeimage.decls" in your userlibs folder. |
.lib " " ;FreeImage Module Decls ;Load and save image functions FiLoadImage%(filename$) FiSaveImage%(image, filename$) FiLoad%(filename$) FiRead%(dib) FiSave%(dib, filename$) FiWrite%(image) FiUnload(dib) ;Load and save anim image functions FiLoadAnimImage%(filename$, index, frames) FiSaveAnimImage%(image, filename$, frames, index) FiAnimFrames%(filename$, index, frames) FiOpenAnim%(filename$, opentype, flags) FiCloseAnim(dib, flags) ;Image manipulation functions FiRescale%(bitmap, scale, filter) FiRotateClassic%(dib, angle#) FiRotateClassicEx%(dib, angle#, bgcolor) FiAdjustGamma%(dib, gamma#) FiAdjustBrightness%(dib, brightness#) FiAdjustContrast%(dib, contrast#) FiAdjustIntensity%(dib, intensity#) ;Information functions FiGetWidth%(dib) FiGetHeight%(dib) FiGetBPP%(dib) ;Clipboard functions FiCopyToClipboard%(dib) FiPasteFromClipboard%() ;Bank functions FiBankFromFile%(filename$) FiBankToFile%(bank, filename$, size) FiLoadFromBank%(bank) ;Zlib functions FiZlibLoadImage%(filename$, datafile$) FiZlibPack%(filename$, datafile$) FiZlibUnpack%(filename$, datafile$) FiGZipLoadImage%(filename$, datafile$) FiGZip%(filename$, datafile$) FiGUnzip%(filename$, datafile$) ;Memory stream functions FiSaveToMemory%(filename$) FiLoadFromMemory%(stream) FiMemoryToFile%(stream, filename$) FiMemorySize%(stream) FiCloseMemory(stream) ;FiRotateClassicEx functions FiRotateAny%(hsrc, angle#, bgcolor) FiRotate45%(hsrc, angle#, bgcolor) FiHorizontalSkew%(hsrc, hdst, row, offset, weight, bgcolor) FiVerticalSkew%(hsrc, hdst, col, offset, weight, bgcolor) FiRotate90%(hsrc) FiRotate180%(hsrc) FiRotate270%(hsrc) ;FloatToDouble functions FiFloatToDouble%(value#, dpart) FiDoubleToFloat#(dho, dhi) FiFloatToInt%(value#) FiIntToFloat#(value) .lib "Kernel32.dll" ;Memory Management Functions FiApiGlobalAlloc%(uFlags,dwBytes):"GlobalAlloc" FiApiGlobalLock%(hmem):"GlobalLock" FiApiGlobalUnlock%(hmem):"GlobalUnlock" FiApiBankToMemory(dst, src*, len):"RtlMoveMemory" FiApiMemoryToBank(dst*, src, len):"RtlMoveMemory" .lib "User32.dll" ;Clipboard Functions FiApiCloseClipboard%():"CloseClipboard" FiApiEmptyClipboard%():"EmptyClipboard" FiApiGetClipboardData%(uFormat):"GetClipboardData" FiApiIsClipboardFormatAvailable%(format):"IsClipboardFormatAvailable" FiApiOpenClipboard%(hwnd):"OpenClipboard" FiApiSetClipboardData%(uFormat,hData):"SetClipboardData" .lib "FreeImage.dll" ;FreeImage 3.10.0 Decls ;http://freeimage.sourceforge.net/ ;Init / Error Routines FreeImage_Initialise(load_local_plugins_only):"_FreeImage_Initialise@4" FreeImage_DeInitialise():"_FreeImage_DeInitialise@0" ;Version Routines FreeImage_GetVersion$():"_FreeImage_GetVersion@0" FreeImage_GetCopyrightMessage$():"_FreeImage_GetCopyrightMessage@0" ;Message Output Functions FreeImage_SetOutputMessageStdCall(omf):"_FreeImage_SetOutputMessageStdCall@4" FreeImage_SetOutputMessage(omf):"_FreeImage_SetOutputMessage@4" FreeImage_OutputMessageProc(fif,fmt$):"FreeImage_OutputMessageProc" ;Allocate / Clone / Unload Routines FreeImage_Allocate%(width,height,bpp,red_mask,green_mask,blue_mask):"_FreeImage_Allocate@24" FreeImage_AllocateT%(type,width,height,bpp,red_mask,green_mask,blue_mask):"_FreeImage_AllocateT@28" FreeImage_Clone%(dib):"_FreeImage_Clone@4" FreeImage_Unload(dib):"_FreeImage_Unload@4" ;Load / Save Routines FreeImage_Load%(fif,filename$,flags):"_FreeImage_Load@12" FreeImage_LoadU%(fif,filename$,flags):"_FreeImage_LoadU@12" FreeImage_LoadFromHandle%(fif,io*,handle,flags):"_FreeImage_LoadFromHandle@16" FreeImage_Save%(fif,dib,filename$,flags):"_FreeImage_Save@16" FreeImage_SaveU%(fif,dib,filename$,flags):"_FreeImage_SaveU@16" FreeImage_SaveToHandle%(fif,dib,io*,handle,flags):"_FreeImage_SaveToHandle@20" ;Memory I/O Stream Routines FreeImage_OpenMemory%(data*,size_in_bytes):"_FreeImage_OpenMemory@8" FreeImage_CloseMemory(stream):"_FreeImage_CloseMemory@4" FreeImage_LoadFromMemory%(fif,stream,flags):"_FreeImage_LoadFromMemory@12" FreeImage_SaveToMemory%(fif,dib,stream,flags):"_FreeImage_SaveToMemory@16" FreeImage_TellMemory%(stream):"_FreeImage_TellMemory@4" FreeImage_SeekMemory%(stream,offset,origin):"_FreeImage_SeekMemory@12" FreeImage_AcquireMemory%(stream,data*,size_in_bytes*):"_FreeImage_AcquireMemory@12" FreeImage_ReadMemory%(buffer,size,count,stream):"_FreeImage_ReadMemory@16" FreeImage_WriteMemory%(buffer,size,count,stream):"_FreeImage_WriteMemory@16" FreeImage_LoadMultiBitmapFromMemory%(fif,stream,flags):"_FreeImage_LoadMultiBitmapFromMemory@12" ;Plugin Interface FreeImage_RegisterLocalPlugin%(proc_address,format$,description$,extension$,regexpr$):"_FreeImage_RegisterLocalPlugin@20" FreeImage_RegisterExternalPlugin%(path$,format$,description$,extension$,regexpr$):"_FreeImage_RegisterExternalPlugin@20" FreeImage_GetFIFCount%():"_FreeImage_GetFIFCount@0" FreeImage_SetPluginEnabled%(fif,enable):"_FreeImage_SetPluginEnabled@8" FreeImage_IsPluginEnabled%(fif):"_FreeImage_IsPluginEnabled@4" FreeImage_GetFIFFromFormat%(format$):"_FreeImage_GetFIFFromFormat@4" FreeImage_GetFIFFromMime%(mime$):"_FreeImage_GetFIFFromMime@4" FreeImage_GetFormatFromFIF$(fif):"_FreeImage_GetFormatFromFIF@4" FreeImage_GetFIFExtensionList$(fif):"_FreeImage_GetFIFExtensionList@4" FreeImage_GetFIFDescription$(fif):"_FreeImage_GetFIFDescription@4" FreeImage_GetFIFRegExpr$(fif):"_FreeImage_GetFIFRegExpr@4" FreeImage_GetFIFMimeType$(fif):"_FreeImage_GetFIFMimeType@4" FreeImage_GetFIFFromFilename%(filename$):"_FreeImage_GetFIFFromFilename@4" FreeImage_GetFIFFromFilenameU%(filename$):"_FreeImage_GetFIFFromFilenameU@4" FreeImage_FIFSupportsReading%(fif):"_FreeImage_FIFSupportsReading@4" FreeImage_FIFSupportsWriting%(fif):"_FreeImage_FIFSupportsWriting@4" FreeImage_FIFSupportsExportBPP%(fif,bpp):"_FreeImage_FIFSupportsExportBPP@8" FreeImage_FIFSupportsExportType%(fif,type):"_FreeImage_FIFSupportsExportType@8" FreeImage_FIFSupportsICCProfiles%(fif):"_FreeImage_FIFSupportsICCProfiles@4" ;Multipaging Interface FreeImage_OpenMultiBitmap%(fif,filename$,create_new,read_only,keep_cache_in_memory,flags):"_FreeImage_OpenMultiBitmap@24" FreeImage_CloseMultiBitmap%(bitmap,flags):"_FreeImage_CloseMultiBitmap@8" FreeImage_GetPageCount%(bitmap):"_FreeImage_GetPageCount@4" FreeImage_AppendPage(bitmap,data):"_FreeImage_AppendPage@8" FreeImage_InsertPage(bitmap,page,data):"_FreeImage_InsertPage@12" FreeImage_DeletePage(bitmap,page):"_FreeImage_DeletePage@8" FreeImage_LockPage%(bitmap,page):"_FreeImage_LockPage@8" FreeImage_UnlockPage(bitmap,page,changed):"_FreeImage_UnlockPage@12" FreeImage_MovePage%(bitmap,target,source):"_FreeImage_MovePage@12" FreeImage_GetLockedPageNumbers%(bitmap,pages,count*):"_FreeImage_GetLockedPageNumbers@12" ;Filetype Request Routines FreeImage_GetFileType%(filename$,size):"_FreeImage_GetFileType@8" FreeImage_GetFileTypeU%(filename$,size):"_FreeImage_GetFileTypeU@8" FreeImage_GetFileTypeFromHandle%(io*,handle,size):"_FreeImage_GetFileTypeFromHandle@12" FreeImage_GetFileTypeFromMemory%(stream,size):"_FreeImage_GetFileTypeFromMemory@8" ;Image Type Request Routine FreeImage_GetImageType%(dib):"_FreeImage_GetImageType@4" ;FreeImage Helper Routines FreeImage_IsLittleEndian%():"_FreeImage_IsLittleEndian@0" FreeImage_LookupX11Color%(szColor$,nRed*,nGreen*,nBlue*):"_FreeImage_LookupX11Color@16" FreeImage_LookupSVGColor%(szColor$,nRed*,nGreen*,nBlue*):"_FreeImage_LookupSVGColor@16" ;Pixel Access Routines FreeImage_GetBits%(dib):"_FreeImage_GetBits@4" FreeImage_GetScanLine%(dib,scanline):"_FreeImage_GetScanLine@8" FreeImage_GetPixelIndex%(dib,x,y,value*):"_FreeImage_GetPixelIndex@16" FreeImage_GetPixelColor%(dib,x,y,value*):"_FreeImage_GetPixelColor@16" FreeImage_SetPixelIndex%(dib,x,y,value*):"_FreeImage_SetPixelIndex@16" FreeImage_SetPixelColor%(dib,x,y,value*):"_FreeImage_SetPixelColor@16" ;DIB Info Routines FreeImage_GetColorsUsed%(dib):"_FreeImage_GetColorsUsed@4" FreeImage_GetBPP%(dib):"_FreeImage_GetBPP@4" FreeImage_GetWidth%(dib):"_FreeImage_GetWidth@4" FreeImage_GetHeight%(dib):"_FreeImage_GetHeight@4" FreeImage_GetLine%(dib):"_FreeImage_GetLine@4" FreeImage_GetPitch%(dib):"_FreeImage_GetPitch@4" FreeImage_GetDIBSize%(dib):"_FreeImage_GetDIBSize@4" FreeImage_GetPalette%(dib):"_FreeImage_GetPalette@4" FreeImage_GetDotsPerMeterX%(dib):"_FreeImage_GetDotsPerMeterX@4" FreeImage_GetDotsPerMeterY%(dib):"_FreeImage_GetDotsPerMeterY@4" FreeImage_SetDotsPerMeterX(dib,res):"_FreeImage_SetDotsPerMeterX@8" FreeImage_SetDotsPerMeterY(dib,res):"_FreeImage_SetDotsPerMeterY@8" FreeImage_GetInfoHeader%(dib):"_FreeImage_GetInfoHeader@4" FreeImage_GetInfo%(dib):"_FreeImage_GetInfo@4" FreeImage_GetColorType%(dib):"_FreeImage_GetColorType@4" FreeImage_GetRedMask%(dib):"_FreeImage_GetRedMask@4" FreeImage_GetGreenMask%(dib):"_FreeImage_GetGreenMask@4" FreeImage_GetBlueMask%(dib):"_FreeImage_GetBlueMask@4" FreeImage_GetTransparencyCount%(dib):"_FreeImage_GetTransparencyCount@4" FreeImage_GetTransparencyTable%(dib):"_FreeImage_GetTransparencyTable@4" FreeImage_SetTransparent(dib,enabled):"_FreeImage_SetTransparent@8" FreeImage_SetTransparencyTable(dib,table*,count):"_FreeImage_SetTransparencyTable@12" FreeImage_IsTransparent%(dib):"_FreeImage_IsTransparent@4" FreeImage_SetTransparentIndex(dib,index):"_FreeImage_SetTransparentIndex@8" FreeImage_GetTransparentIndex%(dib):"_FreeImage_GetTransparentIndex@4" FreeImage_HasBackgroundColor%(dib):"_FreeImage_HasBackgroundColor@4" FreeImage_GetBackgroundColor%(dib,bkcolor*):"_FreeImage_GetBackgroundColor@8" FreeImage_SetBackgroundColor%(dib,bkcolor*):"_FreeImage_SetBackgroundColor@8" ;ICC Profile Routines FreeImage_GetICCProfile%(dib):"_FreeImage_GetICCProfile@4" FreeImage_CreateICCProfile%(dib,data,size):"_FreeImage_CreateICCProfile@12" FreeImage_DestroyICCProfile%(dib):"_FreeImage_DestroyICCProfile@4" ;Line Conversion Routines FreeImage_ConvertLine1To4(target*,source*,width_in_pixels):"_FreeImage_ConvertLine1To4@12" FreeImage_ConvertLine8To4(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine8To4@16" FreeImage_ConvertLine16To4_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To4_555@12" FreeImage_ConvertLine16To4_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To4_565@12" FreeImage_ConvertLine24To4(target*,source*,width_in_pixels):"_FreeImage_ConvertLine24To4@12" FreeImage_ConvertLine32To4(target*,source*,width_in_pixels):"_FreeImage_ConvertLine32To4@12" FreeImage_ConvertLine1To8(target*,source*,width_in_pixels):"_FreeImage_ConvertLine1To8@12" FreeImage_ConvertLine4To8(target*,source*,width_in_pixels):"_FreeImage_ConvertLine4To8@12" FreeImage_ConvertLine16To8_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To8_555@12" FreeImage_ConvertLine16To8_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To8_565@12" FreeImage_ConvertLine24To8(target*,source*,width_in_pixels):"_FreeImage_ConvertLine24To8@12" FreeImage_ConvertLine32To8(target*,source*,width_in_pixels):"_FreeImage_ConvertLine32To8@12" FreeImage_ConvertLine1To16_555(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine1To16_555@16" FreeImage_ConvertLine4To16_555(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine4To16_555@16" FreeImage_ConvertLine8To16_555(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine8To16_555@16" FreeImage_ConvertLine16_565_To16_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16_565_To16_555@12" FreeImage_ConvertLine24To16_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine24To16_555@12" FreeImage_ConvertLine32To16_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine32To16_555@12" FreeImage_ConvertLine1To16_565(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine1To16_565@16" FreeImage_ConvertLine4To16_565(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine4To16_565@16" FreeImage_ConvertLine8To16_565(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine8To16_565@16" FreeImage_ConvertLine16_555_To16_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16_555_To16_565@12" FreeImage_ConvertLine24To16_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine24To16_565@12" FreeImage_ConvertLine32To16_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine32To16_565@12" FreeImage_ConvertLine1To24(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine1To24@16" FreeImage_ConvertLine4To24(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine4To24@16" FreeImage_ConvertLine8To24(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine8To24@16" FreeImage_ConvertLine16To24_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To24_555@12" FreeImage_ConvertLine16To24_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To24_565@12" FreeImage_ConvertLine32To24(target*,source*,width_in_pixels):"_FreeImage_ConvertLine32To24@12" FreeImage_ConvertLine1To32(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine1To32@16" FreeImage_ConvertLine4To32(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine4To32@16" FreeImage_ConvertLine8To32(target*,source*,width_in_pixels,palette*):"_FreeImage_ConvertLine8To32@16" FreeImage_ConvertLine16To32_555(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To32_555@12" FreeImage_ConvertLine16To32_565(target*,source*,width_in_pixels):"_FreeImage_ConvertLine16To32_565@12" FreeImage_ConvertLine24To32(target*,source*,width_in_pixels):"_FreeImage_ConvertLine24To32@12" ;Smart Conversion Routines FreeImage_ConvertTo4Bits%(dib):"_FreeImage_ConvertTo4Bits@4" FreeImage_ConvertTo8Bits%(dib):"_FreeImage_ConvertTo8Bits@4" FreeImage_ConvertToGreyscale%(dib):"_FreeImage_ConvertToGreyscale@4" FreeImage_ConvertTo16Bits555%(dib):"_FreeImage_ConvertTo16Bits555@4" FreeImage_ConvertTo16Bits565%(dib):"_FreeImage_ConvertTo16Bits565@4" FreeImage_ConvertTo24Bits%(dib):"_FreeImage_ConvertTo24Bits@4" FreeImage_ConvertTo32Bits%(dib):"_FreeImage_ConvertTo32Bits@4" FreeImage_ColorQuantize%(dib,quantize):"_FreeImage_ColorQuantize@8" FreeImage_ColorQuantizeEx%(dib,quantize,PaletteSize,ReserveSize,ReservePalette*):"_FreeImage_ColorQuantizeEx@20" FreeImage_Threshold%(dib,T):"_FreeImage_Threshold@8" FreeImage_Dither%(dib,algorithm):"_FreeImage_Dither@8" FreeImage_ConvertFromRawBits%(bits*,width,height,pitch,bpp,red_mask,green_mask,blue_mask,topdown):"_FreeImage_ConvertFromRawBits@36" FreeImage_ConvertToRawBits(bits*,dib,pitch,bpp,red_mask,green_mask,blue_mask,topdown):"_FreeImage_ConvertToRawBits@32" FreeImage_ConvertToRGBF%(dib):"_FreeImage_ConvertToRGBF@4" FreeImage_ConvertToStandardType%(src,scale_linear):"_FreeImage_ConvertToStandardType@8" FreeImage_ConvertToType%(src,dst_type,scale_linear):"_FreeImage_ConvertToType@12" ;tone mapping operators FreeImage_ToneMapping%(dib,tmo,first_param_dlo,first_param_dhi,second_param_dlo,second_param_dlo):"_FreeImage_ToneMapping@24" FreeImage_TmoDrago03%(src,gamma_dlo,gamma_dhi,exposure_dlo,exposure_dhi):"_FreeImage_TmoDrago03@20" FreeImage_TmoReinhard05%(src,intensity_dlo,intensity_dhi,contrast_dlo,contrast_dhi):"_FreeImage_TmoReinhard05@20" FreeImage_TmoFattal02%(src,color_saturation_dlo,color_saturation_dhi,attenuation_dlo,attenuation_dhi):"_FreeImage_TmoFattal02@20" ;ZLib Interface FreeImage_ZLibCompress%(target*,target_size,source*,source_size):"_FreeImage_ZLibCompress@16" FreeImage_ZLibUncompress%(target*,target_size,source*,source_size):"_FreeImage_ZLibUncompress@16" FreeImage_ZLibGZip%(target*,target_size,source*,source_size):"_FreeImage_ZLibGZip@16" FreeImage_ZLibGUnzip%(target*,target_size,source*,source_size):"_FreeImage_ZLibGUnzip@16" FreeImage_ZLibCRC32%(crc,source*,source_size):"_FreeImage_ZLibCRC32@12" ;Metadata Routines ;tag creation / destruction FreeImage_CreateTag%():"_FreeImage_CreateTag@0" FreeImage_DeleteTag(tag):"_FreeImage_DeleteTag@4" FreeImage_CloneTag%(tag):"_FreeImage_CloneTag@4" ;tag getters and setters FreeImage_GetTagKey$(tag):"_FreeImage_GetTagKey@4" FreeImage_GetTagDescription$(tag):"_FreeImage_GetTagDescription@4" FreeImage_GetTagID%(tag):"_FreeImage_GetTagID@4" FreeImage_GetTagType%(tag):"_FreeImage_GetTagType@4" FreeImage_GetTagCount%(tag):"_FreeImage_GetTagCount@4" FreeImage_GetTagLength%(tag):"_FreeImage_GetTagLength@4" FreeImage_GetTagValue%(tag):"_FreeImage_GetTagValue@4" FreeImage_SetTagKey%(tag,key$):"_FreeImage_SetTagKey@8" FreeImage_SetTagDescription%(tag,description$):"_FreeImage_SetTagDescription@8" FreeImage_SetTagID%(tag,id):"_FreeImage_SetTagID@8" FreeImage_SetTagType%(tag,type):"_FreeImage_SetTagType@8" FreeImage_SetTagCount%(tag,count):"_FreeImage_SetTagCount@8" FreeImage_SetTagLength%(tag,length):"_FreeImage_SetTagLength@8" FreeImage_SetTagValue%(tag,value):"_FreeImage_SetTagValue@8" ;iterator FreeImage_FindFirstMetadata%(model,dib,tag):"_FreeImage_FindFirstMetadata@12" FreeImage_FindNextMetadata%(mdhandle,tag):"_FreeImage_FindNextMetadata@8" FreeImage_FindCloseMetadata(mdhandle):"_FreeImage_FindCloseMetadata@4" ;metadata setter and getter FreeImage_SetMetadata%(model,dib,key$,tag):"_FreeImage_SetMetadata@16" FreeImage_GetMetadata%(model,dib,key$,tag):"_FreeImage_GetMetadata@16" ;helpers FreeImage_GetMetadataCount%(model,dib):"_FreeImage_GetMetadataCount@8" ;tag to C string conversion FreeImage_TagToString$(model,tag,Make$):"_FreeImage_TagToString@12" ;Image Manipulation Toolkit ;rotation and flipping FreeImage_RotateClassic%(dib,angle_dlo,angle_dhi):"_FreeImage_RotateClassic@12" FreeImage_RotateEx%(dib,angle_dlo,angle_dhi,x_shift_dlo,x_shift_dhi,y_shift_dlo,y_shift_dhi,x_origin_dlo,x_origin_dhi,y_origin_dlo,y_origin_dhi,use_mask):"_FreeImage_RotateEx@48" FreeImage_FlipHorizontal%(dib):"_FreeImage_FlipHorizontal@4" FreeImage_FlipVertical%(dib):"_FreeImage_FlipVertical@4" FreeImage_JPEGTransform%(src_file$,dst_file$,operation,perfect):"_FreeImage_JPEGTransform@16" ;upsampling / downsampling FreeImage_Rescale%(dib,dst_width,dst_height,filter):"_FreeImage_Rescale@16" FreeImage_MakeThumbnail%(dib,max_pixel_size,convert):"_FreeImage_MakeThumbnail@12" ;color manipulation routines (point operations) FreeImage_AdjustCurve%(dib,LUT*,channel):"_FreeImage_AdjustCurve@12" FreeImage_AdjustGamma%(dib,gamma_dlo,gamma_dhi):"_FreeImage_AdjustGamma@12" FreeImage_AdjustBrightness%(dib,percentage_dlo,percentage_dhi):"_FreeImage_AdjustBrightness@12" FreeImage_AdjustContrast%(dib,percentage_dlo,percentage_dhi):"_FreeImage_AdjustContrast@12" FreeImage_Invert%(dib):"_FreeImage_Invert@4" FreeImage_GetHistogram%(dib,histo*,channel):"_FreeImage_GetHistogram@12" FreeImage_GetAdjustColorsLookupTable%(LUT*,brightness_dlo,brightness_dhi,contrast_dlo,contrast_dhi,gamma_dlo,gamma_dhi,invert):"_FreeImage_GetAdjustColorsLookupTable@32" FreeImage_AdjustColors%(dib,brightness_dlo,brightness_dhi,contrast_dlo,contrast_dhi,gamma_dlo,gamma_dhi,invert):"_FreeImage_AdjustColors@32" FreeImage_ApplyColorMapping%(dib,srccolors*,dstcolors*,count,ignore_alpha,swap):"_FreeImage_ApplyColorMapping@24" FreeImage_SwapColors%(dib,color_a*,color_b*,ignore_alpha):"_FreeImage_SwapColors@16" FreeImage_ApplyPaletteIndexMapping%(dib,srcindices*,dstindices*,count,swap):"_FreeImage_ApplyPaletteIndexMapping@20" FreeImage_SwapPaletteIndices%(dib,index_a*,index_b*):"_FreeImage_SwapPaletteIndices@12" ;channel processing routines FreeImage_GetChannel%(dib,channel):"_FreeImage_GetChannel@8" FreeImage_SetChannel%(dib,dib8,channel):"_FreeImage_SetChannel@12" FreeImage_GetComplexChannel%(src,channel):"_FreeImage_GetComplexChannel@8" FreeImage_SetComplexChannel%(dst,src,channel):"_FreeImage_SetComplexChannel@12" ;copy / paste / composite routines FreeImage_Copy%(dib,left,top,right,bottom):"_FreeImage_Copy@20" FreeImage_Paste%(dst,src,left,top,alpha):"_FreeImage_Paste@20" FreeImage_Composite%(fg,useFileBkg,appBkColor*,bg):"_FreeImage_Composite@16" FreeImage_JPEGCrop%(src_file$,dst_file$,left,top,right,bottom):"_FreeImage_JPEGCrop@24" FreeImage_PreMultiplyWithAlpha%(dib):"_FreeImage_PreMultiplyWithAlpha@4" ;miscellaneous algorithms FreeImage_MultigridPoissonSolver%(Laplacian,ncycle):"_FreeImage_MultigridPoissonSolver@8" |